Dienynes
두 개의 이중 결합과 하나의 3결합이 들어 있는 유기 화합물이다.
화학 원료를 구입해야하는 경우 요청 정보를 제출하여최신견적을받으십시오.
Dienynes의 학술 논문
-
Regio- and stereoselective C-C bond formation between alkynes: Synthesis of linear dienynes from alkynes
화학 물질
-
C5H4CHC6H4CH3Ir(P(C6H5)3)2(CH3CN)2(1+)*BF4(1-)=[C5H4CHC6H4CH3Ir(P(C6H5)3)2(CH3CN)2]BF4
-
-
Substituent effects in tandem ring-closing metathesis reactions of dienynes
화학 물질
-
toluene-4-sulfonic acid 1-but-3-enyl-6-methyl-hept-5-enyl ester
-
